C21H31N3O3S — CID 20853225
1-(cyclopropanecarbonyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 20853225) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20853225 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC1CCN(CCCNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-16-7-12-23(13-8-16)11-2-10-22-28(26,27)19-5-6-20-18(15-19)9-14-24(20)21(25)17-3-4-17/h5-6,15-17,22H,2-4,7-14H2,1H3 |
| InChIKey | LFFKJWIBRMQVRX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|