C22H34N4O3S — CID 20853294
1-(cyclobutanecarbonyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 20853294) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 1-(cyclobutanecarbonyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(cyclobutanecarbonyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20853294 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-(cyclobutanecarbonyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN1CCN(CCCNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-2-24-13-15-25(16-14-24)11-4-10-23-30(28,29)20-7-8-21-19(17-20)9-12-26(21)22(27)18-5-3-6-18/h7-8,17-18,23H,2-6,9-16H2,1H3 |
| InChIKey | UTVAPJBSTFRPOO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|