C24H30N2O4S — CID 100561594
N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 100561594) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 100561594 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(C)(C)c1ccc(OCCNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-24(2,3)19-6-8-20(9-7-19)30-15-13-25-31(28,29)21-10-11-22-18(16-21)12-14-26(22)23(27)17-4-5-17/h6-11,16-17,25H,4-5,12-15H2,1-3H3 |
| InChIKey | UKVXSRSSYSDWKN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|