C22H28N4O4S — CID 89237286
N-[4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide (PubChem CID 89237286) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89237286 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]phenyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
| SMILES | C=CC(=O)NCCCN(C)S(=O)(=O)c1ccc(NC(=O)c2cc3c([nH]2)CCCC3)cc1 |
| InChI | InChI=1S/C22H28N4O4S/c1-3-21(27)23-13-6-14-26(2)31(29,30)18-11-9-17(10-12-18)24-22(28)20-15-16-7-4-5-8-19(16)25-20/h3,9-12,15,25H,1,4-8,13-14H2,2H3,(H,23,27)(H,24,28) |
| InChIKey | HEOPSDJRHPPYGW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|