C24H29N3O4S — CID 89239167
4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 89239167) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 89239167 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[methyl-[3-(prop-2-enoylamino)propyl]sulfamoyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | C=CC(=O)NCCCN(C)S(=O)(=O)c1ccc(C(=O)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-3-23(28)25-16-7-17-27(2)32(30,31)20-14-12-19(13-15-20)24(29)26-22-11-6-9-18-8-4-5-10-21(18)22/h3-5,8,10,12-15,22H,1,6-7,9,11,16-17H2,2H3,(H,25,28)(H,26,29) |
| InChIKey | JECLOVYQMBXACU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|