C27H26N4O4S — CID 505038
N-[3-(dimethylsulfamoyl)phenyl]-3-(4-methylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide (PubChem CID 505038) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-3-(4-methylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-3-(4-methylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 505038 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-3-(4-methylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
| SMILES | Cc1ccnc(C(=O)CC(=O)N(Cc2ccc3ccccc3c2)c2cccc(S(=O)(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C27H26N4O4S/c1-19-13-14-28-27(29-19)25(32)17-26(33)31(18-20-11-12-21-7-4-5-8-22(21)15-20)23-9-6-10-24(16-23)36(34,35)30(2)3/h4-16H,17-18H2,1-3H3 |
| InChIKey | KPNJRJJGVDJVIP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|