C22H17NO6 — CID 504949
3-[(3-carboxy-3-oxopropanoyl)-(naphthalen-2-ylmethyl)amino]benzoic acid (PubChem CID 504949) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 3-[(3-carboxy-3-oxopropanoyl)-(naphthalen-2-ylmethyl)amino]benzoic acid.
| Compound Name | 3-[(3-carboxy-3-oxopropanoyl)-(naphthalen-2-ylmethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 504949 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-[(3-carboxy-3-oxopropanoyl)-(naphthalen-2-ylmethyl)amino]benzoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H17NO6/c24-19(22(28)29)12-20(25)23(18-7-3-6-17(11-18)21(26)27)13-14-8-9-15-4-1-2-5-16(15)10-14/h1-11H,12-13H2,(H,26,27)(H,28,29) |
| InChIKey | HDHNNPYNDUXDHW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|