C26H24N2O3 — CID 142214435
N-(3-acetylphenyl)-4-ethenylimino-N-(naphthalen-2-ylmethyl)-3-oxopentanamide (PubChem CID 142214435) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-ethenylimino-N-(naphthalen-2-ylmethyl)-3-oxopentanamide.
| Compound Name | N-(3-acetylphenyl)-4-ethenylimino-N-(naphthalen-2-ylmethyl)-3-oxopentanamide |
|---|---|
| PubChem CID | 142214435 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-(3-acetylphenyl)-4-ethenylimino-N-(naphthalen-2-ylmethyl)-3-oxopentanamide |
| SMILES | C=C/N=C(\C)C(=O)CC(=O)N(Cc1ccc2ccccc2c1)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C26H24N2O3/c1-4-27-18(2)25(30)16-26(31)28(24-11-7-10-22(15-24)19(3)29)17-20-12-13-21-8-5-6-9-23(21)14-20/h4-15H,1,16-17H2,2-3H3/b27-18+ |
| InChIKey | NQDAQYPSXFXZFX-OVVQPSECSA-N |
| XLogP | 5.14 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|