C23H25N3O3S2 — CID 18775229
N-benzyl-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(3-methylphenyl)acetamide (PubChem CID 18775229) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-benzyl-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(3-methylphenyl)acetamide.
| Compound Name | N-benzyl-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18775229 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-benzyl-2-[[5-(dimethylsulfamoyl)-2-pyridinyl]sulfanyl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(N(Cc2ccccc2)C(=O)CSc2ccc(S(=O)(=O)N(C)C)cn2)c1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-18-8-7-11-20(14-18)26(16-19-9-5-4-6-10-19)23(27)17-30-22-13-12-21(15-24-22)31(28,29)25(2)3/h4-15H,16-17H2,1-3H3 |
| InChIKey | LTFFRFUNZTVIJA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |