C40H46N2O5 — CID 69317538
8-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-5-phenylmethoxy-4H-1,4-benzoxazin-3-one (PubChem CID 69317538) has the molecular formula C40H46N2O5 and a molecular weight of 634.82 g/mol. Its IUPAC name is 8-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-5-phenylmethoxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-5-phenylmethoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 69317538 |
| Molecular Formula | C40H46N2O5 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | 8-[2-[benzyl-[6-(4-phenylbutoxy)hexyl]amino]acetyl]-5-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(C(=O)CN(CCCCCCOCCCCc3ccccc3)Cc3ccccc3)ccc(OCc3ccccc3)c2N1 |
| InChI | InChI=1S/C40H46N2O5/c43-36(35-23-24-37(39-40(35)47-31-38(44)41-39)46-30-34-21-10-5-11-22-34)29-42(28-33-19-8-4-9-20-33)25-13-1-2-14-26-45-27-15-12-18-32-16-6-3-7-17-32/h3-11,16-17,19-24H,1-2,12-15,18,25-31H2,(H,41,44) |
| InChIKey | FZZLWTLZUKFRDH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|