C17H13NO5 — CID 12017520
2-oxo-2-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)acetaldehyde (PubChem CID 12017520) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-oxo-2-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)acetaldehyde.
| Compound Name | 2-oxo-2-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)acetaldehyde |
|---|---|
| PubChem CID | 12017520 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-oxo-2-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)acetaldehyde |
| SMILES | O=CC(=O)c1ccc(OCc2ccccc2)c2c1OCC(=O)N2 |
| InChI | InChI=1S/C17H13NO5/c19-8-13(20)12-6-7-14(16-17(12)23-10-15(21)18-16)22-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,18,21) |
| InChIKey | GMTCPNVGTCYTHQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|