C18H16ClNO4 — CID 174602329
8-(2-chloroacetyl)-5-phenylmethoxy-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174602329) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is 8-(2-chloroacetyl)-5-phenylmethoxy-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 8-(2-chloroacetyl)-5-phenylmethoxy-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174602329 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 8-(2-chloroacetyl)-5-phenylmethoxy-3,4-dihydro-2H-1,4-benzoxazine-3-carbaldehyde |
| SMILES | O=CC1COc2c(C(=O)CCl)ccc(OCc3ccccc3)c2N1 |
| InChI | InChI=1S/C18H16ClNO4/c19-8-15(22)14-6-7-16(23-10-12-4-2-1-3-5-12)17-18(14)24-11-13(9-21)20-17/h1-7,9,13,20H,8,10-11H2 |
| InChIKey | NSRNGFPRLDUHJW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|