C34H45N3O6 — CID 66845478
1-[4-[2-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]phenyl]-3-phenylurea (PubChem CID 66845478) has the molecular formula C34H45N3O6 and a molecular weight of 591.75 g/mol. Its IUPAC name is 1-[4-[2-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 66845478 |
| Molecular Formula | C34H45N3O6 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | 1-[4-[2-[6-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]phenyl]-3-phenylurea |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCCCCCOCCOCc3ccc(NC(=O)Nc4ccccc4)cc3)ccc2O1 |
| InChI | InChI=1S/C34H45N3O6/c1-34(2)42-25-28-22-27(14-17-32(28)43-34)31(38)23-35-18-8-3-4-9-19-40-20-21-41-24-26-12-15-30(16-13-26)37-33(39)36-29-10-6-5-7-11-29/h5-7,10-17,22,31,35,38H,3-4,8-9,18-21,23-25H2,1-2H3,(H2,36,37,39)/t31-/m0/s1 |
| InChIKey | PKOKPKMBUPKMMX-HKBQPEDESA-N |
| XLogP | 6.39 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|