C39H64N2O8SSi — CID 66845057
N-cyclohexyl-3-[2-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide (PubChem CID 66845057) has the molecular formula C39H64N2O8SSi and a molecular weight of 749.10 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide.
| Compound Name | N-cyclohexyl-3-[2-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66845057 |
| Molecular Formula | C39H64N2O8SSi |
| Molecular Weight | 749.10 g/mol |
| Exact Mass | 748.42 |
| IUPAC Name | N-cyclohexyl-3-[2-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]ethoxymethyl]-N-(2-trimethylsilylethoxymethyl)benzenesulfonamide |
| SMILES | CC1(C)OCc2cc([C@H](O)CNCCCCCCOCCOCc3cccc(S(=O)(=O)N(COCC[Si](C)(C)C)C4CCCCC4)c3)ccc2O1 |
| InChI | InChI=1S/C39H64N2O8SSi/c1-39(2)48-30-34-27-33(18-19-38(34)49-39)37(42)28-40-20-11-6-7-12-21-45-22-23-46-29-32-14-13-17-36(26-32)50(43,44)41(35-15-9-8-10-16-35)31-47-24-25-51(3,4)5/h13-14,17-19,26-27,35,37,40,42H,6-12,15-16,20-25,28-31H2,1-5H3/t37-/m1/s1 |
| InChIKey | VGGFYNSWCGPQST-DIPNUNPCSA-N |
| XLogP | 7.38 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.10 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|