C28H42N2O6S — CID 69200859
4-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]benzenesulfonamide (PubChem CID 69200859) has the molecular formula C28H42N2O6S and a molecular weight of 534.72 g/mol. Its IUPAC name is 4-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]benzenesulfonamide.
| Compound Name | 4-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69200859 |
| Molecular Formula | C28H42N2O6S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 4-[4-[6-[[(2S)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]hexoxy]butyl]benzenesulfonamide |
| SMILES | CC1(C)OCc2cc([C@H](O)CNCCCCCCOCCCCc3ccc(S(N)(=O)=O)cc3)ccc2O1 |
| InChI | InChI=1S/C28H42N2O6S/c1-28(2)35-21-24-19-23(12-15-27(24)36-28)26(31)20-30-16-6-3-4-7-17-34-18-8-5-9-22-10-13-25(14-11-22)37(29,32)33/h10-15,19,26,30-31H,3-9,16-18,20-21H2,1-2H3,(H2,29,32,33)/t26-/m1/s1 |
| InChIKey | LSGYLQJBCXEXNW-AREMUKBSSA-N |
| XLogP | 4.20 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|