C54H59N5O4 — CID 142890269
(1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-[4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethanol (PubChem CID 142890269) has the molecular formula C54H59N5O4 and a molecular weight of 842.10 g/mol. Its IUPAC name is (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-[4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethanol.
| Compound Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-[4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethanol |
|---|---|
| PubChem CID | 142890269 |
| Molecular Formula | C54H59N5O4 |
| Molecular Weight | 842.10 g/mol |
| Exact Mass | 841.46 |
| IUPAC Name | (1R)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[6-[4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butoxy]hexylamino]ethanol |
| SMILES | CC1(C)OCc2cc([C@@H](O)CNCCCCCCOCCCCc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)ccc2O1 |
| InChI | InChI=1S/C54H59N5O4/c1-53(2)62-40-44-38-43(33-34-51(44)63-53)50(60)39-55-35-17-3-4-18-36-61-37-19-16-20-41-29-31-42(32-30-41)48-27-14-15-28-49(48)52-56-57-58-59(52)54(45-21-8-5-9-22-45,46-23-10-6-11-24-46)47-25-12-7-13-26-47/h5-15,21-34,38,50,55,60H,3-4,16-20,35-37,39-40H2,1-2H3/t50-/m0/s1 |
| InChIKey | XVFXCORHYGTBJM-DPDRHGIRSA-N |
| XLogP | 10.72 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.10 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|