C36H49NO5 — CID 10188310
(1S)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[[(1R)-2-hydroxy-1-phenylethyl]-[6-(4-phenylbutoxy)hexyl]amino]ethanol (PubChem CID 10188310) has the molecular formula C36H49NO5 and a molecular weight of 575.79 g/mol. Its IUPAC name is (1S)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[[(1R)-2-hydroxy-1-phenylethyl]-[6-(4-phenylbutoxy)hexyl]amino]ethanol.
| Compound Name | (1S)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[[(1R)-2-hydroxy-1-phenylethyl]-[6-(4-phenylbutoxy)hexyl]amino]ethanol |
|---|---|
| PubChem CID | 10188310 |
| Molecular Formula | C36H49NO5 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | (1S)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-[[(1R)-2-hydroxy-1-phenylethyl]-[6-(4-phenylbutoxy)hexyl]amino]ethanol |
| SMILES | CC1(C)OCc2cc([C@H](O)CN(CCCCCCOCCCCc3ccccc3)[C@@H](CO)c3ccccc3)ccc2O1 |
| InChI | InChI=1S/C36H49NO5/c1-36(2)41-28-32-25-31(20-21-35(32)42-36)34(39)26-37(33(27-38)30-18-9-6-10-19-30)22-12-3-4-13-23-40-24-14-11-17-29-15-7-5-8-16-29/h5-10,15-16,18-21,25,33-34,38-39H,3-4,11-14,17,22-24,26-28H2,1-2H3/t33-,34+/m0/s1 |
| InChIKey | XQXZRWYCBGQGNT-SZAHLOSFSA-N |
| XLogP | 7.00 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|