C19H22O6S — CID 91081623
3-[(2R)-2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]propane-1-sulfonic acid (PubChem CID 91081623) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[(2R)-2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2R)-2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91081623 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[(2R)-2-(phenylmethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCc1ccc2c(c1)OC[C@@H](COCc1ccccc1)O2 |
| InChI | InChI=1S/C19H22O6S/c20-26(21,22)10-4-7-15-8-9-18-19(11-15)24-14-17(25-18)13-23-12-16-5-2-1-3-6-16/h1-3,5-6,8-9,11,17H,4,7,10,12-14H2,(H,20,21,22)/t17-/m1/s1 |
| InChIKey | BVUUTQZBUNPQSH-QGZVFWFLSA-N |
| XLogP | 2.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|