C11H14O4 — CID 129411607
(2R)-2-(ethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 129411607) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R)-2-(ethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | (2R)-2-(ethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 129411607 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2R)-2-(ethoxymethyl)-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | CCOC[C@@H]1COc2cc(O)ccc2O1 |
| InChI | InChI=1S/C11H14O4/c1-2-13-6-9-7-14-11-5-8(12)3-4-10(11)15-9/h3-5,9,12H,2,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | ATOBIKDXVGSYJV-SECBINFHSA-N |
| XLogP | 1.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |