C16H16O5S — CID 88633200
4-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid (PubChem CID 88633200) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88633200 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(CCC2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H16O5S/c17-22(18,19)14-9-6-12(7-10-14)5-8-13-11-20-15-3-1-2-4-16(15)21-13/h1-4,6-7,9-10,13H,5,8,11H2,(H,17,18,19) |
| InChIKey | ZCAGJMFZRKCTQS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|