C18H17NO8S — CID 87941382
4-[2-[(3R)-6-nitro-5-(2-oxoethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]benzenesulfonic acid (PubChem CID 87941382) has the molecular formula C18H17NO8S and a molecular weight of 407.40 g/mol. Its IUPAC name is 4-[2-[(3R)-6-nitro-5-(2-oxoethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-[(3R)-6-nitro-5-(2-oxoethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87941382 |
| Molecular Formula | C18H17NO8S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-[2-[(3R)-6-nitro-5-(2-oxoethyl)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]benzenesulfonic acid |
| SMILES | O=CCc1c([N+](=O)[O-])ccc2c1O[C@H](CCc1ccc(S(=O)(=O)O)cc1)CO2 |
| InChI | InChI=1S/C18H17NO8S/c20-10-9-15-16(19(21)22)7-8-17-18(15)27-13(11-26-17)4-1-12-2-5-14(6-3-12)28(23,24)25/h2-3,5-8,10,13H,1,4,9,11H2,(H,23,24,25)/t13-/m1/s1 |
| InChIKey | GTHFVJFTKMICJR-CYBMUJFWSA-N |
| XLogP | 2.36 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|