C30H39N5O8 — CID 159829319
acetic acid;carbamimidoyl N'-[3-[2-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]ethyl]phenoxy]ethoxymethyl]phenyl]carbamimidate (PubChem CID 159829319) has the molecular formula C30H39N5O8 and a molecular weight of 597.67 g/mol. Its IUPAC name is acetic acid;carbamimidoyl N'-[3-[2-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]ethyl]phenoxy]ethoxymethyl]phenyl]carbamimidate.
| Compound Name | acetic acid;carbamimidoyl N'-[3-[2-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]ethyl]phenoxy]ethoxymethyl]phenyl]carbamimidate |
|---|---|
| PubChem CID | 159829319 |
| Molecular Formula | C30H39N5O8 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | acetic acid;carbamimidoyl N'-[3-[2-[4-[2-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]ethyl]phenoxy]ethoxymethyl]phenyl]carbamimidate |
| SMILES | CC(=O)O.[H]/N=C(\N)O/C(N)=N/c1cccc(COCCOc2ccc(CCNC[C@H](O)c3ccc(O)c(CO)c3)cc2)c1 |
| InChI | InChI=1S/C28H35N5O6.C2H4O2/c29-27(30)39-28(31)33-23-3-1-2-20(14-23)18-37-12-13-38-24-7-4-19(5-8-24)10-11-32-16-26(36)21-6-9-25(35)22(15-21)17-34;1-2(3)4/h1-9,14-15,26,32,34-36H,10-13,16-18H2,(H3,29,30)(H2,31,33);1H3,(H,3,4)/t26-;/m0./s1 |
| InChIKey | NNGIDASAABAQKK-SNYZSRNZSA-N |
| XLogP | 2.29 |
| TPSA | 225.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|