C35H53N3O7 — CID 87836053
[cyclohexyl-[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methylcarbamoyl]amino] acetate (PubChem CID 87836053) has the molecular formula C35H53N3O7 and a molecular weight of 627.82 g/mol. Its IUPAC name is [cyclohexyl-[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methylcarbamoyl]amino] acetate.
| Compound Name | [cyclohexyl-[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methylcarbamoyl]amino] acetate |
|---|---|
| PubChem CID | 87836053 |
| Molecular Formula | C35H53N3O7 |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.39 |
| IUPAC Name | [cyclohexyl-[[3-[4-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]methylcarbamoyl]amino] acetate |
| SMILES | CC(=O)ON(C(=O)NCc1cccc(CCCCOCCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C35H53N3O7/c1-27(40)45-38(32-15-5-4-6-16-32)35(43)37-24-29-14-11-13-28(22-29)12-7-10-21-44-20-9-3-2-8-19-36-25-34(42)30-17-18-33(41)31(23-30)26-39/h11,13-14,17-18,22-23,32,34,36,39,41-42H,2-10,12,15-16,19-21,24-26H2,1H3,(H,37,43)/t34-/m1/s1 |
| InChIKey | DCVAJJFBXCULNP-UUWRZZSWSA-N |
| XLogP | 5.43 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|