C25H36I2N2O4 — CID 177469951
4-[2-[6-[4-(4-amino-3-(125I)iodophenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)-6-(125I)iodo(125I2)phenol (PubChem CID 177469951) has the molecular formula C25H36I2N2O4 and a molecular weight of 678.38 g/mol. Its IUPAC name is 4-[2-[6-[4-(4-amino-3-(125I)iodophenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)-6-(125I)iodo(125I2)phenol.
| Compound Name | 4-[2-[6-[4-(4-amino-3-(125I)iodophenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)-6-(125I)iodo(125I2)phenol |
|---|---|
| PubChem CID | 177469951 |
| Molecular Formula | C25H36I2N2O4 |
| Molecular Weight | 678.38 g/mol |
| Exact Mass | 678.08 |
| IUPAC Name | 4-[2-[6-[4-(4-amino-3-(125I)iodophenyl)butoxy]hexylamino]-1-hydroxyethyl]-2-(hydroxymethyl)-6-(125I)iodo(125I2)phenol |
| SMILES | Nc1ccc(CCCCOCCCCCCNCC(O)c2cc([125I])c(O)c(CO)c2)cc1[125I] |
| InChI | InChI=1S/C25H36I2N2O4/c26-21-13-18(8-9-23(21)28)7-3-6-12-33-11-5-2-1-4-10-29-16-24(31)19-14-20(17-30)25(32)22(27)15-19/h8-9,13-15,24,29-32H,1-7,10-12,16-17,28H2/i26-2,27-2 |
| InChIKey | UOPCCLKEGZBVCE-KRZOQYDJSA-N |
| XLogP | 4.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|