C14H17FN2OS — CID 106045212
1-(4-fluorophenyl)-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethanol (PubChem CID 106045212) has the molecular formula C14H17FN2OS and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 106045212 |
| Molecular Formula | C14H17FN2OS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]ethanol |
| SMILES | Cc1nc(CCNCC(O)c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C14H17FN2OS/c1-10-17-13(9-19-10)6-7-16-8-14(18)11-2-4-12(15)5-3-11/h2-5,9,14,16,18H,6-8H2,1H3 |
| InChIKey | KQPGULHWXAVJPX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|