C16H24Cl2N2O3 — CID 52933040
4-[4-[2-(tert-butylamino)-1-hydroxyethyl]-2,6-dichloroanilino]butanoic acid (PubChem CID 52933040) has the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.29 g/mol. Its IUPAC name is 4-[4-[2-(tert-butylamino)-1-hydroxyethyl]-2,6-dichloroanilino]butanoic acid.
| Compound Name | 4-[4-[2-(tert-butylamino)-1-hydroxyethyl]-2,6-dichloroanilino]butanoic acid |
|---|---|
| PubChem CID | 52933040 |
| Molecular Formula | C16H24Cl2N2O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[4-[2-(tert-butylamino)-1-hydroxyethyl]-2,6-dichloroanilino]butanoic acid |
| SMILES | CC(C)(C)NCC(O)c1cc(Cl)c(NCCCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N2O3/c1-16(2,3)20-9-13(21)10-7-11(17)15(12(18)8-10)19-6-4-5-14(22)23/h7-8,13,19-21H,4-6,9H2,1-3H3,(H,22,23) |
| InChIKey | BCWPERMFDTUJBS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|