C12H19NOS2 — CID 165378100
1-[3,5-bis(sulfanyl)phenyl]-2-(tert-butylamino)ethanol (PubChem CID 165378100) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-[3,5-bis(sulfanyl)phenyl]-2-(tert-butylamino)ethanol.
| Compound Name | 1-[3,5-bis(sulfanyl)phenyl]-2-(tert-butylamino)ethanol |
|---|---|
| PubChem CID | 165378100 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-[3,5-bis(sulfanyl)phenyl]-2-(tert-butylamino)ethanol |
| SMILES | CC(C)(C)NCC(O)c1cc(S)cc(S)c1 |
| InChI | InChI=1S/C12H19NOS2/c1-12(2,3)13-7-11(14)8-4-9(15)6-10(16)5-8/h4-6,11,13-16H,7H2,1-3H3 |
| InChIKey | NHNROAPEIPTMCB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|