C11H20Cl2N2O2 — CID 138472967
5-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]pyridin-3-ol;dihydrochloride (PubChem CID 138472967) has the molecular formula C11H20Cl2N2O2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 5-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]pyridin-3-ol;dihydrochloride.
| Compound Name | 5-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]pyridin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 138472967 |
| Molecular Formula | C11H20Cl2N2O2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]pyridin-3-ol;dihydrochloride |
| SMILES | CC(C)(C)NC[C@H](O)c1cncc(O)c1.Cl.Cl |
| InChI | InChI=1S/C11H18N2O2.2ClH/c1-11(2,3)13-7-10(15)8-4-9(14)6-12-5-8;;/h4-6,10,13-15H,7H2,1-3H3;2*1H/t10-;;/m0../s1 |
| InChIKey | JNQFKJVFZQWFDP-XRIOVQLTSA-N |
| XLogP | 2.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |