About [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate
[5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate (PubChem CID 54068018) has the molecular formula C24H33NO4
and a molecular weight of 399.53 g/mol. Its IUPAC name is [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate |
| PubChem CID | 54068018 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate |
| SMILES | CNCC(O)c1ccc(Oc2ccc(C)cc2)c(COC(=O)CCC(C)(C)C)c1 |
| InChI | InChI=1S/C24H33NO4/c1-17-6-9-20(10-7-17)29-22-11-8-18(21(26)15-25-5)14-19(22)16-28-23(27)12-13-24(2,3)4/h6-11,14,21,25-26H,12-13,15-16H2,1-5H3 |
| InChIKey | MEKQYWVZQSYDSA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate?
The IUPAC name of [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate (CID 54068018) is [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate.
What is the SMILES notation for [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate?
The canonical SMILES for [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate is CNCC(O)c1ccc(Oc2ccc(C)cc2)c(COC(=O)CCC(C)(C)C)c1.
What is the InChIKey of [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate?
The InChIKey is MEKQYWVZQSYDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO4/c1-17-6-9-20(10-7-17)29-22-11-8-18(21(26)15-25-5)14-19(22)16-28-23(27)12-13-24(2,3)4/h6-11,14,21,25-26H,12-13,15-16H2,1-5H3.
What are the key properties of [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate?
[5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate has a molecular weight of 399.53 g/mol, XLogP of 4.91, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-hydroxy-2-(methylamino)ethyl]-2-(4-methylphenoxy)phenyl]methyl 4,4-dimethylpentanoate is sourced from PubChem (CID 54068018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).