C18H30ClNO3 — CID 70463616
[2-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] 3,3-dimethylbutanoate;hydrochloride (PubChem CID 70463616) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is [2-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] 3,3-dimethylbutanoate;hydrochloride.
| Compound Name | [2-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] 3,3-dimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 70463616 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [2-[2-(tert-butylamino)-1-hydroxyethyl]phenyl] 3,3-dimethylbutanoate;hydrochloride |
| SMILES | CC(C)(C)CC(=O)Oc1ccccc1C(O)CNC(C)(C)C.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-17(2,3)11-16(21)22-15-10-8-7-9-13(15)14(20)12-19-18(4,5)6;/h7-10,14,19-20H,11-12H2,1-6H3;1H |
| InChIKey | DUXIVJFUEOGLFT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|