C30H49O9PSSi — CID 87508099
[(2S)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 87508099) has the molecular formula C30H49O9PSSi and a molecular weight of 644.84 g/mol. Its IUPAC name is [(2S)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87508099 |
| Molecular Formula | C30H49O9PSSi |
| Molecular Weight | 644.84 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | [(2S)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)c2ccc(OP(=O)(OC(C)(C)C)OC(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C30H49O9PSSi/c1-22-13-16-25(17-14-22)41(33,34)35-21-26(31)23-15-18-27(24(19-23)20-36-42(11,12)30(8,9)10)37-40(32,38-28(2,3)4)39-29(5,6)7/h13-19,26,31H,20-21H2,1-12H3/t26-/m1/s1 |
| InChIKey | DYILYJUPHGFVMO-AREMUKBSSA-N |
| XLogP | 8.07 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.84 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|