C18H25BrN2O2Si — CID 140753775
1-[(3-bromophenyl)methyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazole-3-carbaldehyde (PubChem CID 140753775) has the molecular formula C18H25BrN2O2Si and a molecular weight of 409.40 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazole-3-carbaldehyde.
| Compound Name | 1-[(3-bromophenyl)methyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 140753775 |
| Molecular Formula | C18H25BrN2O2Si |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazole-3-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C=O)nn1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H25BrN2O2Si/c1-18(2,3)24(4,5)23-13-17-10-16(12-22)20-21(17)11-14-7-6-8-15(19)9-14/h6-10,12H,11,13H2,1-5H3 |
| InChIKey | NUQAWMZMIGOMEU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|