C20H31BrN2O2Si — CID 140753812
2-[1-[(3-bromophenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-5-yl]propan-2-ol (PubChem CID 140753812) has the molecular formula C20H31BrN2O2Si and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[1-[(3-bromophenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-5-yl]propan-2-ol.
| Compound Name | 2-[1-[(3-bromophenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 140753812 |
| Molecular Formula | C20H31BrN2O2Si |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[1-[(3-bromophenyl)methyl]-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-5-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(CO[Si](C)(C)C(C)(C)C)nn1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C20H31BrN2O2Si/c1-19(2,3)26(6,7)25-14-17-12-18(20(4,5)24)23(22-17)13-15-9-8-10-16(21)11-15/h8-12,24H,13-14H2,1-7H3 |
| InChIKey | VIGKJWVFCBJUCT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|