C15H18BrClN2O — CID 63276258
[1-[(3-bromophenyl)methyl]-3-tert-butyl-5-chloropyrazol-4-yl]methanol (PubChem CID 63276258) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is [1-[(3-bromophenyl)methyl]-3-tert-butyl-5-chloropyrazol-4-yl]methanol.
| Compound Name | [1-[(3-bromophenyl)methyl]-3-tert-butyl-5-chloropyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 63276258 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [1-[(3-bromophenyl)methyl]-3-tert-butyl-5-chloropyrazol-4-yl]methanol |
| SMILES | CC(C)(C)c1nn(Cc2cccc(Br)c2)c(Cl)c1CO |
| InChI | InChI=1S/C15H18BrClN2O/c1-15(2,3)13-12(9-20)14(17)19(18-13)8-10-5-4-6-11(16)7-10/h4-7,20H,8-9H2,1-3H3 |
| InChIKey | ISLUVQPIXALQKF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |