C12H10ClF3N2O — CID 43333641
[1-benzyl-5-chloro-3-(trifluoromethyl)pyrazol-4-yl]methanol (PubChem CID 43333641) has the molecular formula C12H10ClF3N2O and a molecular weight of 290.67 g/mol. Its IUPAC name is [1-benzyl-5-chloro-3-(trifluoromethyl)pyrazol-4-yl]methanol.
| Compound Name | [1-benzyl-5-chloro-3-(trifluoromethyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 43333641 |
| Molecular Formula | C12H10ClF3N2O |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | [1-benzyl-5-chloro-3-(trifluoromethyl)pyrazol-4-yl]methanol |
| SMILES | OCc1c(C(F)(F)F)nn(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C12H10ClF3N2O/c13-11-9(7-19)10(12(14,15)16)17-18(11)6-8-4-2-1-3-5-8/h1-5,19H,6-7H2 |
| InChIKey | LGYRFCZQYSJNDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |