C29H40N2O3Si — CID 71282066
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2,4-dimethoxyphenyl)methyl]-1-methyl-7,8-dihydro-6H-benzo[f]indol-5-imine (PubChem CID 71282066) has the molecular formula C29H40N2O3Si and a molecular weight of 492.74 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2,4-dimethoxyphenyl)methyl]-1-methyl-7,8-dihydro-6H-benzo[f]indol-5-imine.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2,4-dimethoxyphenyl)methyl]-1-methyl-7,8-dihydro-6H-benzo[f]indol-5-imine |
|---|---|
| PubChem CID | 71282066 |
| Molecular Formula | C29H40N2O3Si |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2,4-dimethoxyphenyl)methyl]-1-methyl-7,8-dihydro-6H-benzo[f]indol-5-imine |
| SMILES | COc1ccc(C/N=C2\CCCc3cc4c(cc32)cc(CO[Si](C)(C)C(C)(C)C)n4C)c(OC)c1 |
| InChI | InChI=1S/C29H40N2O3Si/c1-29(2,3)35(7,8)34-19-23-14-22-15-25-20(16-27(22)31(23)4)10-9-11-26(25)30-18-21-12-13-24(32-5)17-28(21)33-6/h12-17H,9-11,18-19H2,1-8H3/b30-26+ |
| InChIKey | DDXRTQCWJAEIEW-URGPHPNLSA-N |
| XLogP | 7.04 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|