C20H23ClN2O2 — CID 172859203
8-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-1-benzazepin-5-imine (PubChem CID 172859203) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 8-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-1-benzazepin-5-imine.
| Compound Name | 8-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-1-benzazepin-5-imine |
|---|---|
| PubChem CID | 172859203 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 8-(chloromethyl)-N-[(2,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-1-benzazepin-5-imine |
| SMILES | COc1ccc(C/N=C2\CCCNc3cc(CCl)ccc32)c(OC)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-24-16-7-6-15(20(11-16)25-2)13-23-18-4-3-9-22-19-10-14(12-21)5-8-17(18)19/h5-8,10-11,22H,3-4,9,12-13H2,1-2H3/b23-18+ |
| InChIKey | ZCXWFXJOZTYFHC-PTGBLXJZSA-N |
| XLogP | 4.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|