C34H44N2O4Si — CID 172733671
15-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2,4-dimethoxyphenyl)methyl]-3,6-dimethyl-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-4-one (PubChem CID 172733671) has the molecular formula C34H44N2O4Si and a molecular weight of 572.82 g/mol. Its IUPAC name is 15-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2,4-dimethoxyphenyl)methyl]-3,6-dimethyl-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-4-one.
| Compound Name | 15-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2,4-dimethoxyphenyl)methyl]-3,6-dimethyl-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-4-one |
|---|---|
| PubChem CID | 172733671 |
| Molecular Formula | C34H44N2O4Si |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 15-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2,4-dimethoxyphenyl)methyl]-3,6-dimethyl-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-4-one |
| SMILES | COc1ccc(Cc2c(C)c3c(n(C)c2=O)-c2cc4cc(CO[Si](C)(C)C(C)(C)C)[nH]c4cc2CCC3)c(OC)c1 |
| InChI | InChI=1S/C34H44N2O4Si/c1-21-27-12-10-11-22-18-30-24(15-25(35-30)20-40-41(8,9)34(2,3)4)17-29(22)32(27)36(5)33(37)28(21)16-23-13-14-26(38-6)19-31(23)39-7/h13-15,17-19,35H,10-12,16,20H2,1-9H3 |
| InChIKey | IDDYEMZLQNJOAE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|