C23H37N3O4Si — CID 131738960
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;1H-imidazole (PubChem CID 131738960) has the molecular formula C23H37N3O4Si and a molecular weight of 447.65 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;1H-imidazole.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;1H-imidazole |
|---|---|
| PubChem CID | 131738960 |
| Molecular Formula | C23H37N3O4Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one;1H-imidazole |
| SMILES | COc1ccc(CN2CC(CO[Si](C)(C)C(C)(C)C)CC2=O)c(OC)c1.c1c[nH]cn1 |
| InChI | InChI=1S/C20H33NO4Si.C3H4N2/c1-20(2,3)26(6,7)25-14-15-10-19(22)21(12-15)13-16-8-9-17(23-4)11-18(16)24-5;1-2-5-3-4-1/h8-9,11,15H,10,12-14H2,1-7H3;1-3H,(H,4,5) |
| InChIKey | XPRKTERNFZZNNA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|