C29H42N2O3Si — CID 89421765
1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylindol-5-yl]-N-[(2,4-dimethoxyphenyl)methyl]butan-1-imine (PubChem CID 89421765) has the molecular formula C29H42N2O3Si and a molecular weight of 494.75 g/mol. Its IUPAC name is 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylindol-5-yl]-N-[(2,4-dimethoxyphenyl)methyl]butan-1-imine.
| Compound Name | 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylindol-5-yl]-N-[(2,4-dimethoxyphenyl)methyl]butan-1-imine |
|---|---|
| PubChem CID | 89421765 |
| Molecular Formula | C29H42N2O3Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylindol-5-yl]-N-[(2,4-dimethoxyphenyl)methyl]butan-1-imine |
| SMILES | CCC/C(=N\Cc1ccc(OC)cc1OC)c1ccc2c(c1)cc(CO[Si](C)(C)C(C)(C)C)n2C |
| InChI | InChI=1S/C29H42N2O3Si/c1-10-11-26(30-19-22-12-14-25(32-6)18-28(22)33-7)21-13-15-27-23(16-21)17-24(31(27)5)20-34-35(8,9)29(2,3)4/h12-18H,10-11,19-20H2,1-9H3/b30-26+ |
| InChIKey | IPCRFGFTKUNSFR-URGPHPNLSA-N |
| XLogP | 7.51 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|