C23H31NO2Si — CID 11440428
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 11440428) has the molecular formula C23H31NO2Si and a molecular weight of 381.59 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 11440428 |
| Molecular Formula | C23H31NO2Si |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | COc1ccc2c(c1)CCC/C2=N\c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H31NO2Si/c1-23(2,3)27(5,6)26-19-12-10-18(11-13-19)24-22-9-7-8-17-16-20(25-4)14-15-21(17)22/h10-16H,7-9H2,1-6H3/b24-22+ |
| InChIKey | XFKWCJIOKGVVJX-ZNTNEXAZSA-N |
| XLogP | 6.54 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|