C24H25ClF2N5O7P — CID 145045957
2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145045957) has the molecular formula C24H25ClF2N5O7P and a molecular weight of 599.92 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145045957 |
| Molecular Formula | C24H25ClF2N5O7P |
| Molecular Weight | 599.92 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(OCc2cccc(Cl)c2)OCc2oc(=O)oc2C2CCC(F)(F)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H25ClF2N5O7P/c25-16-3-1-2-14(8-16)10-36-40(13-35-7-6-32-12-29-18-20(32)30-22(28)31-21(18)33)37-11-17-19(39-23(34)38-17)15-4-5-24(26,27)9-15/h1-3,8,12,15H,4-7,9-11,13H2,(H3,28,30,31,33) |
| InChIKey | KGEDMRVQSMLPKB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|