C24H26F2N5O8P — CID 137014459
2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 137014459) has the molecular formula C24H26F2N5O8P and a molecular weight of 581.47 g/mol. Its IUPAC name is 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014459 |
| Molecular Formula | C24H26F2N5O8P |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-oxo-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(=O)(OCc2ccccc2)OCc2oc(=O)oc2C2CCC(F)(F)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H26F2N5O8P/c25-24(26)7-6-16(10-24)19-17(38-23(33)39-19)12-37-40(34,36-11-15-4-2-1-3-5-15)14-35-9-8-31-13-28-18-20(31)29-22(27)30-21(18)32/h1-5,13,16H,6-12,14H2,(H3,27,29,30,32) |
| InChIKey | IPWINKAVBQVLEV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 177.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|