C8H10N5Na2O3PS — CID 54771818
disodium;9-[2-(dioxidophosphinothioylmethoxy)ethyl]purin-6-amine (PubChem CID 54771818) has the molecular formula C8H10N5Na2O3PS and a molecular weight of 333.22 g/mol. Its IUPAC name is disodium;9-[2-(dioxidophosphinothioylmethoxy)ethyl]purin-6-amine.
| Compound Name | disodium;9-[2-(dioxidophosphinothioylmethoxy)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 54771818 |
| Molecular Formula | C8H10N5Na2O3PS |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | disodium;9-[2-(dioxidophosphinothioylmethoxy)ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP([O-])([O-])=S.[Na+].[Na+] |
| InChI | InChI=1S/C8H12N5O3PS.2Na/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-16-5-17(14,15)18;;/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,18);;/q;2*+1/p-2 |
| InChIKey | HQIIYLURLHFHOW-UHFFFAOYSA-L |
| XLogP | -7.58 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|