C24H24N5O8P — CID 86291341
9-[2-[bis(2,3-dihydro-1,4-benzodioxin-6-yloxy)phosphorylmethoxy]ethyl]purin-6-amine (PubChem CID 86291341) has the molecular formula C24H24N5O8P and a molecular weight of 541.46 g/mol. Its IUPAC name is 9-[2-[bis(2,3-dihydro-1,4-benzodioxin-6-yloxy)phosphorylmethoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[bis(2,3-dihydro-1,4-benzodioxin-6-yloxy)phosphorylmethoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 86291341 |
| Molecular Formula | C24H24N5O8P |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 9-[2-[bis(2,3-dihydro-1,4-benzodioxin-6-yloxy)phosphorylmethoxy]ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(Oc1ccc2c(c1)OCCO2)Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H24N5O8P/c25-23-22-24(27-13-26-23)29(14-28-22)5-6-31-15-38(30,36-16-1-3-18-20(11-16)34-9-7-32-18)37-17-2-4-19-21(12-17)35-10-8-33-19/h1-4,11-14H,5-10,15H2,(H2,25,26,27) |
| InChIKey | OSUNMRGLKCJRLN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|