C26H30N5O5PS2 — CID 90213484
9-[(2R)-2-[[phenoxy-[(4S,5S)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 90213484) has the molecular formula C26H30N5O5PS2 and a molecular weight of 587.66 g/mol. Its IUPAC name is 9-[(2R)-2-[[phenoxy-[(4S,5S)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[phenoxy-[(4S,5S)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 90213484 |
| Molecular Formula | C26H30N5O5PS2 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | 9-[(2R)-2-[[phenoxy-[(4S,5S)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(Oc1ccccc1)O[C@@H]1CSSC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30N5O5PS2/c1-19(12-31-17-30-24-25(27)28-16-29-26(24)31)34-18-37(32,35-21-10-6-3-7-11-21)36-23-15-39-38-14-22(23)33-13-20-8-4-2-5-9-20/h2-11,16-17,19,22-23H,12-15,18H2,1H3,(H2,27,28,29)/t19-,22-,23-,37?/m1/s1 |
| InChIKey | RSTOETNKVVCQIQ-DKCTWQRJSA-N |
| XLogP | 5.41 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|