C27H32N5O5PS2 — CID 123810839
[2-[5-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(4-methylphenoxy)phosphoryl]oxydithian-3-yl]phenyl]methanol (PubChem CID 123810839) has the molecular formula C27H32N5O5PS2 and a molecular weight of 601.69 g/mol. Its IUPAC name is [2-[5-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(4-methylphenoxy)phosphoryl]oxydithian-3-yl]phenyl]methanol.
| Compound Name | [2-[5-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(4-methylphenoxy)phosphoryl]oxydithian-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 123810839 |
| Molecular Formula | C27H32N5O5PS2 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | [2-[5-[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(4-methylphenoxy)phosphoryl]oxydithian-3-yl]phenyl]methanol |
| SMILES | Cc1ccc(OP(=O)(COC(C)Cn2cnc3c(N)ncnc32)OC2CSSC(c3ccccc3CO)C2)cc1 |
| InChI | InChI=1S/C27H32N5O5PS2/c1-18-7-9-21(10-8-18)36-38(34,17-35-19(2)12-32-16-31-25-26(28)29-15-30-27(25)32)37-22-11-24(40-39-14-22)23-6-4-3-5-20(23)13-33/h3-10,15-16,19,22,24,33H,11-14,17H2,1-2H3,(H2,28,29,30) |
| InChIKey | QBVKGKWWQQXUDX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|