C19H23ClN5O4PS2 — CID 123959611
9-[2-[[(3-chlorophenoxy)-(dithian-4-yloxy)phosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 123959611) has the molecular formula C19H23ClN5O4PS2 and a molecular weight of 515.99 g/mol. Its IUPAC name is 9-[2-[[(3-chlorophenoxy)-(dithian-4-yloxy)phosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[2-[[(3-chlorophenoxy)-(dithian-4-yloxy)phosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 123959611 |
| Molecular Formula | C19H23ClN5O4PS2 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 9-[2-[[(3-chlorophenoxy)-(dithian-4-yloxy)phosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(Oc1cccc(Cl)c1)OC1CCSSC1 |
| InChI | InChI=1S/C19H23ClN5O4PS2/c1-13(8-25-11-24-17-18(21)22-10-23-19(17)25)27-12-30(26,29-16-5-6-31-32-9-16)28-15-4-2-3-14(20)7-15/h2-4,7,10-11,13,16H,5-6,8-9,12H2,1H3,(H2,21,22,23) |
| InChIKey | FGOSZVDRTKDKOD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|