C20H26N5O3PS2 — CID 134173198
9-[2-[[[(4R)-dithian-4-yl]oxy-(2-methylphenoxy)phosphanyl]methoxy]propyl]purin-6-amine (PubChem CID 134173198) has the molecular formula C20H26N5O3PS2 and a molecular weight of 479.57 g/mol. Its IUPAC name is 9-[2-[[[(4R)-dithian-4-yl]oxy-(2-methylphenoxy)phosphanyl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[2-[[[(4R)-dithian-4-yl]oxy-(2-methylphenoxy)phosphanyl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 134173198 |
| Molecular Formula | C20H26N5O3PS2 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 9-[2-[[[(4R)-dithian-4-yl]oxy-(2-methylphenoxy)phosphanyl]methoxy]propyl]purin-6-amine |
| SMILES | Cc1ccccc1OP(COC(C)Cn1cnc2c(N)ncnc21)O[C@@H]1CCSSC1 |
| InChI | InChI=1S/C20H26N5O3PS2/c1-14-5-3-4-6-17(14)28-29(27-16-7-8-30-31-10-16)13-26-15(2)9-25-12-24-18-19(21)22-11-23-20(18)25/h3-6,11-12,15-16H,7-10,13H2,1-2H3,(H2,21,22,23)/t15?,16-,29?/m1/s1 |
| InChIKey | JIVQPHGVXTUTFB-IDLZAGIOSA-N |
| XLogP | 4.64 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|