C27H32N5O5PS2 — CID 118491199
9-[(2R)-2-[[(2-methylphenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 118491199) has the molecular formula C27H32N5O5PS2 and a molecular weight of 601.69 g/mol. Its IUPAC name is 9-[(2R)-2-[[(2-methylphenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[(2-methylphenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 118491199 |
| Molecular Formula | C27H32N5O5PS2 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | 9-[(2R)-2-[[(2-methylphenoxy)-[(5R)-5-phenylmethoxydithian-4-yl]oxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | Cc1ccccc1OP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OC1CSSC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H32N5O5PS2/c1-19-8-6-7-11-22(19)36-38(33,18-35-20(2)12-32-17-31-25-26(28)29-16-30-27(25)32)37-24-15-40-39-14-23(24)34-13-21-9-4-3-5-10-21/h3-11,16-17,20,23-24H,12-15,18H2,1-2H3,(H2,28,29,30)/t20-,23+,24?,38?/m1/s1 |
| InChIKey | AJJOJDHTEXBCRF-TUNIFRJVSA-N |
| XLogP | 5.72 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|